Name | Creatine pyruvate |
Synonyms | Creatine pyruvate CREATINE PYRUVATE Creatine pyruvate fandachem 2-Oxo-propanoic acid Pyruvate-creatine mixt N-(Aminoiminomethyl)-N-methyl-glycine mixt. with 2-oxopropanoic acid N-(Aminoiminomethyl)-N-methyl-glycine mixt. with 2-oxopropanoic acid |
CAS | 55965-97-4 |
EINECS | 429-120-5 |
InChI | InChI=1/C4H9N3O2.C3H4O3/c1-7(4(5)6)2-3(8)9;1-2(4)3(5)6/h2H2,1H3,(H3,5,6)(H,8,9);1H3,(H,5,6) |
Molecular Formula | C7H11N3O4 |
Molar Mass | 201.18 |
Boling Point | 271.6°C at 760 mmHg |
Flash Point | 118.1°C |
Vapor Presure | 0.00178mmHg at 25°C |
Storage Condition | 2-8°C |
Use | for pharmaceutical raw materials and food additives |